How to calculate enthalpy change with Hess's law

Hess's law states that the total enthalpy change for a chemical reaction is independent of the pathway taken, depending only on the initial and final states. It applies when determining the standard enthalpy of reaction (ΔHrxn\Delta H^\circ_{rxn}) for a target process using a set of intermediate reactions with known enthalpy changes.

The setup

Identify the target chemical equation for which the enthalpy change is unknown. Gather the provided intermediate chemical equations along with their corresponding standard enthalpy changes (ΔH\Delta H^\circ). Ensure all chemical species include their state of matter (s, l, g, aq).

The steps

  1. Manipulate the intermediate equations (by reversing them or multiplying by a scalar) so that the reactants and products match the target equation. 2. If you reverse an equation, flip the sign of its ΔH\Delta H^\circ. 3. If you multiply an equation by a scalar, multiply its ΔH\Delta H^\circ by the same scalar. 4. Add the manipulated equations together, canceling identical species that appear on both the reactant and product sides. 5. Add the adjusted ΔH\Delta H^\circ values to find the total ΔHrxn\Delta H^\circ_{rxn} for the target equation.

Checking the result

Verify that the summation of the manipulated intermediate equations perfectly matches the target equation. All intermediate species must cancel out entirely. Ensure that species canceled across equations are in the exact same phase; for example, H2O(l)H_2O(l) cannot cancel H2O(g)H_2O(g).

Common errors

A frequent error is forgetting to change the sign of ΔH\Delta H^\circ when reversing an equation. Another is failing to multiply the ΔH\Delta H^\circ value by the same scalar applied to the stoichiometric coefficients. Students also often incorrectly cancel species that are in different phases, leading to an incorrect net equation.

Worked example

Find ΔHrxn\Delta H^\circ_{rxn} for the reaction 2C(s)+H2(g)C2H2(g)2C(s) + H_2(g) \rightarrow C_2H_2(g) given the following intermediate equations: (1) C2H2(g)+52O2(g)2CO2(g)+H2O(l)C_2H_2(g) + \frac{5}{2}O_2(g) \rightarrow 2CO_2(g) + H_2O(l) with ΔH1=1299.5extkJ\Delta H_1 = -1299.5 ext{ kJ}; (2) C(s)+O2(g)CO2(g)C(s) + O_2(g) \rightarrow CO_2(g) with ΔH2=393.5extkJ\Delta H_2 = -393.5 ext{ kJ}; (3) H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) \rightarrow H_2O(l) with ΔH3=285.8extkJ\Delta H_3 = -285.8 ext{ kJ}.

First, reverse equation (1) to put C2H2(g)C_2H_2(g) on the product side: 2CO2(g)+H2O(l)C2H2(g)+52O2(g)2CO_2(g) + H_2O(l) \rightarrow C_2H_2(g) + \frac{5}{2}O_2(g) with ΔH1=+1299.5extkJ\Delta H_1' = +1299.5 ext{ kJ}. Next, multiply equation (2) by 2 to supply the required 2C(s)2C(s) for the reactants: 2C(s)+2O2(g)2CO2(g)2C(s) + 2O_2(g) \rightarrow 2CO_2(g) with ΔH2=2(393.5)=787.0extkJ\Delta H_2' = 2(-393.5) = -787.0 ext{ kJ}. Keep equation (3) as is to provide the H2(g)H_2(g) reactant: H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) \rightarrow H_2O(l) with ΔH3=285.8extkJ\Delta H_3' = -285.8 ext{ kJ}. Sum the manipulated equations: the 2CO2(g)2CO_2(g) and H2O(l)H_2O(l) produced in the intermediate steps cancel with the reactants in the reversed equation (1). The 2O2(g)2O_2(g) and 12O2(g)\frac{1}{2}O_2(g) combine to form 52O2(g)\frac{5}{2}O_2(g), which cancels with the 52O2(g)\frac{5}{2}O_2(g) product. The net equation is 2C(s)+H2(g)C2H2(g)2C(s) + H_2(g) \rightarrow C_2H_2(g). Finally, sum the adjusted enthalpies: ΔHrxn=1299.5787.0285.8=+226.7extkJ\Delta H^\circ_{rxn} = 1299.5 - 787.0 - 285.8 = +226.7 ext{ kJ}.

FAQ

Run your own problem

References: Chemistry 2e, OpenStax, Chapter 5: Thermochemistry · Khan Academy, Thermodynamics: Hess's law and reaction enthalpy change

See also